C22H31NO8 — CID 141142502
(4R)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-5-phenylmethoxypentanoic acid (PubChem CID 141142502) has the molecular formula C22H31NO8 and a molecular weight of 437.49 g/mol. Its IUPAC name is (4R)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-5-phenylmethoxypentanoic acid.
| Compound Name | (4R)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 141142502 |
| Molecular Formula | C22H31NO8 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (4R)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-5-phenylmethoxypentanoic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)[C@H](CCC(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H31NO8/c1-21(2,3)30-19(27)23(20(28)31-22(4,5)6)16(12-13-17(24)25)18(26)29-14-15-10-8-7-9-11-15/h7-11,16H,12-14H2,1-6H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | BBOKQSYAYUOEGR-MRXNPFEDSA-N |
| XLogP | 4.14 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|