C27H40N2O11 — CID 134837645
methyl (2S)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxy-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxycarbonylamino]propanoate (PubChem CID 134837645) has the molecular formula C27H40N2O11 and a molecular weight of 568.62 g/mol. Its IUPAC name is methyl (2S)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxy-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxy-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 134837645 |
| Molecular Formula | C27H40N2O11 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | methyl (2S)-3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]oxy-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](CON(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)N(C(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H40N2O11/c1-25(2,3)38-22(32)28(21(31)36-16-18-14-12-11-13-15-18)19(20(30)35-10)17-37-29(23(33)39-26(4,5)6)24(34)40-27(7,8)9/h11-15,19H,16-17H2,1-10H3/t19-/m0/s1 |
| InChIKey | IOKYGIPKWXINCN-IBGZPJMESA-N |
| XLogP | 5.21 |
| TPSA | 147.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|