C20H31N3O5 — CID 57130823
benzyl N-[(2S)-6-amino-1-(methylamino)-1-oxohexan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 57130823) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is benzyl N-[(2S)-6-amino-1-(methylamino)-1-oxohexan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | benzyl N-[(2S)-6-amino-1-(methylamino)-1-oxohexan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 57130823 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | benzyl N-[(2S)-6-amino-1-(methylamino)-1-oxohexan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CNC(=O)[C@H](CCCCN)N(C(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31N3O5/c1-20(2,3)28-19(26)23(16(17(24)22-4)12-8-9-13-21)18(25)27-14-15-10-6-5-7-11-15/h5-7,10-11,16H,8-9,12-14,21H2,1-4H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | FAQJACUVHIHYEH-INIZCTEOSA-N |
| XLogP | 2.80 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|