C27H42N2O8 — CID 67506291
benzyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[[(2R)-1-ethoxy-1-oxopropan-2-yl]amino]pentanoate (PubChem CID 67506291) has the molecular formula C27H42N2O8 and a molecular weight of 522.64 g/mol. Its IUPAC name is benzyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[[(2R)-1-ethoxy-1-oxopropan-2-yl]amino]pentanoate.
| Compound Name | benzyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[[(2R)-1-ethoxy-1-oxopropan-2-yl]amino]pentanoate |
|---|---|
| PubChem CID | 67506291 |
| Molecular Formula | C27H42N2O8 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | benzyl (2R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[[(2R)-1-ethoxy-1-oxopropan-2-yl]amino]pentanoate |
| SMILES | CCOC(=O)[C@@H](C)NCCC[C@H](C(=O)OCc1ccccc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H42N2O8/c1-9-34-22(30)19(2)28-17-13-16-21(23(31)35-18-20-14-11-10-12-15-20)29(24(32)36-26(3,4)5)25(33)37-27(6,7)8/h10-12,14-15,19,21,28H,9,13,16-18H2,1-8H3/t19-,21-/m1/s1 |
| InChIKey | KGFPWXPJHSMZMU-TZIWHRDSSA-N |
| XLogP | 4.59 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|