C18H28N2O4 — CID 143731224
benzyl 2-[amino-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoate (PubChem CID 143731224) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is benzyl 2-[amino-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoate.
| Compound Name | benzyl 2-[amino-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 143731224 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | benzyl 2-[amino-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoate |
| SMILES | CCCCC(C(=O)OCc1ccccc1)N(N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O4/c1-5-6-12-15(20(19)17(22)24-18(2,3)4)16(21)23-13-14-10-8-7-9-11-14/h7-11,15H,5-6,12-13,19H2,1-4H3 |
| InChIKey | YHUWLTSGNBMZSC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|