C23H35NO6 — CID 15606069
benzyl (2R)-2-[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoyl]oxyheptanoate (PubChem CID 15606069) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is benzyl (2R)-2-[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoyl]oxyheptanoate.
| Compound Name | benzyl (2R)-2-[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoyl]oxyheptanoate |
|---|---|
| PubChem CID | 15606069 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | benzyl (2R)-2-[(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoyl]oxyheptanoate |
| SMILES | CCCCC[C@@H](OC(=O)[C@H](C)N(C)C(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H35NO6/c1-7-8-10-15-19(21(26)28-16-18-13-11-9-12-14-18)29-20(25)17(2)24(6)22(27)30-23(3,4)5/h9,11-14,17,19H,7-8,10,15-16H2,1-6H3/t17-,19+/m0/s1 |
| InChIKey | QHBNMMCFOISCNG-PKOBYXMFSA-N |
| XLogP | 4.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|