C27H36N2O6 — CID 10743475
benzyl (2R)-2-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-(2-methylpropyl)carbamoyl]oxy-3-phenylpropanoate (PubChem CID 10743475) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is benzyl (2R)-2-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-(2-methylpropyl)carbamoyl]oxy-3-phenylpropanoate.
| Compound Name | benzyl (2R)-2-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-(2-methylpropyl)carbamoyl]oxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 10743475 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | benzyl (2R)-2-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-(2-methylpropyl)carbamoyl]oxy-3-phenylpropanoate |
| SMILES | CC(C)CN(C(=O)O[C@H](Cc1ccccc1)C(=O)OCc1ccccc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H36N2O6/c1-20(2)18-29(28(6)25(31)35-27(3,4)5)26(32)34-23(17-21-13-9-7-10-14-21)24(30)33-19-22-15-11-8-12-16-22/h7-16,20,23H,17-19H2,1-6H3/t23-/m1/s1 |
| InChIKey | LTGJCUAWAYVGTE-HSZRJFAPSA-N |
| XLogP | 5.22 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|