C33H46N2O7 — CID 122703375
[3-(4-morpholin-4-ylphenyl)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-4,4-dimethyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate (PubChem CID 122703375) has the molecular formula C33H46N2O7 and a molecular weight of 582.74 g/mol. Its IUPAC name is [3-(4-morpholin-4-ylphenyl)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-4,4-dimethyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate.
| Compound Name | [3-(4-morpholin-4-ylphenyl)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-4,4-dimethyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 122703375 |
| Molecular Formula | C33H46N2O7 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | [3-(4-morpholin-4-ylphenyl)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-4,4-dimethyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H](CC(C)(C)C)C(=O)OC(Cc1ccc(N2CCOCC2)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H46N2O7/c1-32(2,3)22-27(34(7)31(38)42-33(4,5)6)29(36)41-28(30(37)40-23-25-11-9-8-10-12-25)21-24-13-15-26(16-14-24)35-17-19-39-20-18-35/h8-16,27-28H,17-23H2,1-7H3/t27-,28?/m0/s1 |
| InChIKey | VRDCKHAHGHAALS-MBMZGMDYSA-N |
| XLogP | 5.39 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|