C32H44N2O7 — CID 145346365
[1-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-(4-morpholin-4-ylphenyl)-1-oxopropan-2-yl] 3-cyclopropyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 145346365) has the molecular formula C32H44N2O7 and a molecular weight of 568.71 g/mol. Its IUPAC name is [1-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-(4-morpholin-4-ylphenyl)-1-oxopropan-2-yl] 3-cyclopropyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | [1-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-(4-morpholin-4-ylphenyl)-1-oxopropan-2-yl] 3-cyclopropyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 145346365 |
| Molecular Formula | C32H44N2O7 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | [1-[(2E)-2-ethenylpenta-2,4-dienoxy]-3-(4-morpholin-4-ylphenyl)-1-oxopropan-2-yl] 3-cyclopropyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | C=C/C=C(\C=C)COC(=O)C(Cc1ccc(N2CCOCC2)cc1)OC(=O)C(CC1CC1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H44N2O7/c1-7-9-23(8-2)22-39-30(36)28(21-25-12-14-26(15-13-25)34-16-18-38-19-17-34)40-29(35)27(20-24-10-11-24)33(6)31(37)41-32(3,4)5/h7-9,12-15,24,27-28H,1-2,10-11,16-22H2,3-6H3/b23-9+ |
| InChIKey | FLSHKNXHNDUWFV-NUGSKGIGSA-N |
| XLogP | 4.85 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|