benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate

C31H29NO4 — CID 54215648

IUPACbenzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate
SMILESO=C(OCc1ccccc1)[C@H](Cc1ccccc1)OC(=O)N(Cc1ccccc1)Cc1ccccc1
InChIInChI=1S/C31H29NO4/c33-30(35-24-28-19-11-4-12-20-28)29(21-25-13-5-1-6-14-25)36-31(34)32(22-26-15-7-2-8-16-26)23-27-17-9-3-10-18-27/h1-20,29H,21-24H2/t29-/m0/s1
InChIKeyPYZNYMDTHAPVOB-LJAQVGFWSA-N
MW479.58 g/mol
LogP6.18
Rot. Bonds10

About benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate

benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate (PubChem CID 54215648) has the molecular formula C31H29NO4 and a molecular weight of 479.58 g/mol. Its IUPAC name is benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate.

Molecular Properties

Compound Namebenzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate
PubChem CID54215648
Molecular FormulaC31H29NO4
Molecular Weight479.58 g/mol
Exact Mass479.21
IUPAC Namebenzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate
SMILESO=C(OCc1ccccc1)[C@H](Cc1ccccc1)OC(=O)N(Cc1ccccc1)Cc1ccccc1
InChIInChI=1S/C31H29NO4/c33-30(35-24-28-19-11-4-12-20-28)29(21-25-13-5-1-6-14-25)36-31(34)32(22-26-15-7-2-8-16-26)23-27-17-9-3-10-18-27/h1-20,29H,21-24H2/t29-/m0/s1
InChIKeyPYZNYMDTHAPVOB-LJAQVGFWSA-N
XLogP6.18
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms36
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500479.58
LogP ≤ 56.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate?
The IUPAC name of benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate (CID 54215648) is benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate.
What is the SMILES notation for benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate?
The canonical SMILES for benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate is O=C(OCc1ccccc1)[C@H](Cc1ccccc1)OC(=O)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate?
The InChIKey is PYZNYMDTHAPVOB-LJAQVGFWSA-N. The full InChI is InChI=1S/C31H29NO4/c33-30(35-24-28-19-11-4-12-20-28)29(21-25-13-5-1-6-14-25)36-31(34)32(22-26-15-7-2-8-16-26)23-27-17-9-3-10-18-27/h1-20,29H,21-24H2/t29-/m0/s1.
What are the key properties of benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate?
benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate has a molecular weight of 479.58 g/mol, XLogP of 6.18, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-2-(dibenzylcarbamoyloxy)-3-phenylpropanoate is sourced from PubChem (CID 54215648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).