C25H31NO5 — CID 18639022
benzyl (2S)-2-[methyl-(5-methyl-2-oxohexyl)carbamoyl]oxy-3-phenylpropanoate (PubChem CID 18639022) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is benzyl (2S)-2-[methyl-(5-methyl-2-oxohexyl)carbamoyl]oxy-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[methyl-(5-methyl-2-oxohexyl)carbamoyl]oxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 18639022 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | benzyl (2S)-2-[methyl-(5-methyl-2-oxohexyl)carbamoyl]oxy-3-phenylpropanoate |
| SMILES | CC(C)CCC(=O)CN(C)C(=O)O[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H31NO5/c1-19(2)14-15-22(27)17-26(3)25(29)31-23(16-20-10-6-4-7-11-20)24(28)30-18-21-12-8-5-9-13-21/h4-13,19,23H,14-18H2,1-3H3/t23-/m0/s1 |
| InChIKey | IWMJXDSNYAKGNZ-QHCPKHFHSA-N |
| XLogP | 4.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |