C17H24N2O6 — CID 18638910
(2S)-2-[methyl-[methyl(2-methylpropoxycarbonyl)amino]carbamoyl]oxy-3-phenylpropanoic acid (PubChem CID 18638910) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is (2S)-2-[methyl-[methyl(2-methylpropoxycarbonyl)amino]carbamoyl]oxy-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[methyl-[methyl(2-methylpropoxycarbonyl)amino]carbamoyl]oxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18638910 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (2S)-2-[methyl-[methyl(2-methylpropoxycarbonyl)amino]carbamoyl]oxy-3-phenylpropanoic acid |
| SMILES | CC(C)COC(=O)N(C)N(C)C(=O)O[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H24N2O6/c1-12(2)11-24-16(22)18(3)19(4)17(23)25-14(15(20)21)10-13-8-6-5-7-9-13/h5-9,12,14H,10-11H2,1-4H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | RWUGXWUOVQHXGT-AWEZNQCLSA-N |
| XLogP | 2.39 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|