C17H22N2O6 — CID 19753755
2-[methyl-(2-morpholin-4-yl-2-oxoethyl)carbamoyl]oxy-3-phenylpropanoic acid (PubChem CID 19753755) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[methyl-(2-morpholin-4-yl-2-oxoethyl)carbamoyl]oxy-3-phenylpropanoic acid.
| Compound Name | 2-[methyl-(2-morpholin-4-yl-2-oxoethyl)carbamoyl]oxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 19753755 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[methyl-(2-morpholin-4-yl-2-oxoethyl)carbamoyl]oxy-3-phenylpropanoic acid |
| SMILES | CN(CC(=O)N1CCOCC1)C(=O)OC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H22N2O6/c1-18(12-15(20)19-7-9-24-10-8-19)17(23)25-14(16(21)22)11-13-5-3-2-4-6-13/h2-6,14H,7-12H2,1H3,(H,21,22) |
| InChIKey | OJTDKCOMGDVMDI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |