C15H21N3O5 — CID 19753965
2-[[dimethylcarbamoyl(methyl)amino]-methylcarbamoyl]oxy-3-phenylpropanoic acid (PubChem CID 19753965) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[[dimethylcarbamoyl(methyl)amino]-methylcarbamoyl]oxy-3-phenylpropanoic acid.
| Compound Name | 2-[[dimethylcarbamoyl(methyl)amino]-methylcarbamoyl]oxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 19753965 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[[dimethylcarbamoyl(methyl)amino]-methylcarbamoyl]oxy-3-phenylpropanoic acid |
| SMILES | CN(C)C(=O)N(C)N(C)C(=O)OC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H21N3O5/c1-16(2)14(21)17(3)18(4)15(22)23-12(13(19)20)10-11-8-6-5-7-9-11/h5-9,12H,10H2,1-4H3,(H,19,20) |
| InChIKey | YDTQWCHWMKXIEL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|