About benzyl 5-methyl-2-oxohexanoate
benzyl 5-methyl-2-oxohexanoate (PubChem CID 18370146) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is benzyl 5-methyl-2-oxohexanoate.
Molecular Properties
| Compound Name | benzyl 5-methyl-2-oxohexanoate |
| PubChem CID | 18370146 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | benzyl 5-methyl-2-oxohexanoate |
| SMILES | CC(C)CCC(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H18O3/c1-11(2)8-9-13(15)14(16)17-10-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
| InChIKey | MMQVHISMIKNMBZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl 5-methyl-2-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-methyl-2-oxohexanoate?
The IUPAC name of benzyl 5-methyl-2-oxohexanoate (CID 18370146) is benzyl 5-methyl-2-oxohexanoate.
What is the SMILES notation for benzyl 5-methyl-2-oxohexanoate?
The canonical SMILES for benzyl 5-methyl-2-oxohexanoate is CC(C)CCC(=O)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 5-methyl-2-oxohexanoate?
The InChIKey is MMQVHISMIKNMBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-11(2)8-9-13(15)14(16)17-10-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3.
What are the key properties of benzyl 5-methyl-2-oxohexanoate?
benzyl 5-methyl-2-oxohexanoate has a molecular weight of 234.30 g/mol, XLogP of 2.74, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-methyl-2-oxohexanoate is sourced from PubChem (CID 18370146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).