C14H16O6 — CID 134386529
(3S)-3-methoxy-5,6-dioxo-6-phenylmethoxyhexanoic acid (PubChem CID 134386529) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (3S)-3-methoxy-5,6-dioxo-6-phenylmethoxyhexanoic acid.
| Compound Name | (3S)-3-methoxy-5,6-dioxo-6-phenylmethoxyhexanoic acid |
|---|---|
| PubChem CID | 134386529 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (3S)-3-methoxy-5,6-dioxo-6-phenylmethoxyhexanoic acid |
| SMILES | CO[C@H](CC(=O)O)CC(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H16O6/c1-19-11(8-13(16)17)7-12(15)14(18)20-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | QWRUTHXEYTXCNX-NSHDSACASA-N |
| XLogP | 1.18 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|