C17H20O8 — CID 130401923
(3S,4S)-3-ethoxycarbonyl-4-phenylmethoxycarbonylhexanedioic acid (PubChem CID 130401923) has the molecular formula C17H20O8 and a molecular weight of 352.34 g/mol. Its IUPAC name is (3S,4S)-3-ethoxycarbonyl-4-phenylmethoxycarbonylhexanedioic acid.
| Compound Name | (3S,4S)-3-ethoxycarbonyl-4-phenylmethoxycarbonylhexanedioic acid |
|---|---|
| PubChem CID | 130401923 |
| Molecular Formula | C17H20O8 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (3S,4S)-3-ethoxycarbonyl-4-phenylmethoxycarbonylhexanedioic acid |
| SMILES | CCOC(=O)[C@@H](CC(=O)O)[C@H](CC(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H20O8/c1-2-24-16(22)12(8-14(18)19)13(9-15(20)21)17(23)25-10-11-6-4-3-5-7-11/h3-7,12-13H,2,8-10H2,1H3,(H,18,19)(H,20,21)/t12-,13-/m0/s1 |
| InChIKey | CZCMJQNZDUZURO-STQMWFEESA-N |
| XLogP | 1.47 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |