C28H24O8 — CID 101114631
dimethyl 2-[4-[1,3-dioxo-1,3-bis(phenylmethoxy)propan-2-ylidene]cyclohexa-2,5-dien-1-ylidene]propanedioate (PubChem CID 101114631) has the molecular formula C28H24O8 and a molecular weight of 488.49 g/mol. Its IUPAC name is dimethyl 2-[4-[1,3-dioxo-1,3-bis(phenylmethoxy)propan-2-ylidene]cyclohexa-2,5-dien-1-ylidene]propanedioate.
| Compound Name | dimethyl 2-[4-[1,3-dioxo-1,3-bis(phenylmethoxy)propan-2-ylidene]cyclohexa-2,5-dien-1-ylidene]propanedioate |
|---|---|
| PubChem CID | 101114631 |
| Molecular Formula | C28H24O8 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | dimethyl 2-[4-[1,3-dioxo-1,3-bis(phenylmethoxy)propan-2-ylidene]cyclohexa-2,5-dien-1-ylidene]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)=c1ccc(=C(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H24O8/c1-33-25(29)23(26(30)34-2)21-13-15-22(16-14-21)24(27(31)35-17-19-9-5-3-6-10-19)28(32)36-18-20-11-7-4-8-12-20/h3-16H,17-18H2,1-2H3 |
| InChIKey | GFZNXGRXGGDJAW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|