C21H17NO6 — CID 102242689
dimethyl 2-[4-(1-cyano-2-oxo-2-phenylmethoxyethylidene)cyclohexa-2,5-dien-1-ylidene]propanedioate (PubChem CID 102242689) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is dimethyl 2-[4-(1-cyano-2-oxo-2-phenylmethoxyethylidene)cyclohexa-2,5-dien-1-ylidene]propanedioate.
| Compound Name | dimethyl 2-[4-(1-cyano-2-oxo-2-phenylmethoxyethylidene)cyclohexa-2,5-dien-1-ylidene]propanedioate |
|---|---|
| PubChem CID | 102242689 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | dimethyl 2-[4-(1-cyano-2-oxo-2-phenylmethoxyethylidene)cyclohexa-2,5-dien-1-ylidene]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)=c1ccc(=C(C#N)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H17NO6/c1-26-20(24)18(21(25)27-2)16-10-8-15(9-11-16)17(12-22)19(23)28-13-14-6-4-3-5-7-14/h3-11H,13H2,1-2H3 |
| InChIKey | KRXONYMSFOMBAL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|