About benzyl 2-oxodecanoate
benzyl 2-oxodecanoate (PubChem CID 18370296) has the molecular formula C17H24O3
and a molecular weight of 276.38 g/mol. Its IUPAC name is benzyl 2-oxodecanoate.
Molecular Properties
| Compound Name | benzyl 2-oxodecanoate |
| PubChem CID | 18370296 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | benzyl 2-oxodecanoate |
| SMILES | CCCCCCCCC(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24O3/c1-2-3-4-5-6-10-13-16(18)17(19)20-14-15-11-8-7-9-12-15/h7-9,11-12H,2-6,10,13-14H2,1H3 |
| InChIKey | BDUCNWVVUKKMFA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-oxodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-oxodecanoate?
The IUPAC name of benzyl 2-oxodecanoate (CID 18370296) is benzyl 2-oxodecanoate.
What is the SMILES notation for benzyl 2-oxodecanoate?
The canonical SMILES for benzyl 2-oxodecanoate is CCCCCCCCC(=O)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-oxodecanoate?
The InChIKey is BDUCNWVVUKKMFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O3/c1-2-3-4-5-6-10-13-16(18)17(19)20-14-15-11-8-7-9-12-15/h7-9,11-12H,2-6,10,13-14H2,1H3.
What are the key properties of benzyl 2-oxodecanoate?
benzyl 2-oxodecanoate has a molecular weight of 276.38 g/mol, XLogP of 4.05, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-oxodecanoate is sourced from PubChem (CID 18370296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).