C21H22O4 — CID 134392623
benzyl 2,8-dioxo-8-phenyloctanoate (PubChem CID 134392623) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is benzyl 2,8-dioxo-8-phenyloctanoate.
| Compound Name | benzyl 2,8-dioxo-8-phenyloctanoate |
|---|---|
| PubChem CID | 134392623 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | benzyl 2,8-dioxo-8-phenyloctanoate |
| SMILES | O=C(CCCCCC(=O)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H22O4/c22-19(18-12-6-2-7-13-18)14-8-3-9-15-20(23)21(24)25-16-17-10-4-1-5-11-17/h1-2,4-7,10-13H,3,8-9,14-16H2 |
| InChIKey | IIGKKSRVXLAWLL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|