About benzyl 6-amino-2-oxohexanoate
benzyl 6-amino-2-oxohexanoate (PubChem CID 175985284) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is benzyl 6-amino-2-oxohexanoate.
Molecular Properties
| Compound Name | benzyl 6-amino-2-oxohexanoate |
| PubChem CID | 175985284 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | benzyl 6-amino-2-oxohexanoate |
| SMILES | NCCCCC(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c14-9-5-4-8-12(15)13(16)17-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10,14H2 |
| InChIKey | PGCWGRWTPYIZEY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl 6-amino-2-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 6-amino-2-oxohexanoate?
The IUPAC name of benzyl 6-amino-2-oxohexanoate (CID 175985284) is benzyl 6-amino-2-oxohexanoate.
What is the SMILES notation for benzyl 6-amino-2-oxohexanoate?
The canonical SMILES for benzyl 6-amino-2-oxohexanoate is NCCCCC(=O)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 6-amino-2-oxohexanoate?
The InChIKey is PGCWGRWTPYIZEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c14-9-5-4-8-12(15)13(16)17-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10,14H2.
What are the key properties of benzyl 6-amino-2-oxohexanoate?
benzyl 6-amino-2-oxohexanoate has a molecular weight of 235.28 g/mol, XLogP of 1.43, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 6-amino-2-oxohexanoate is sourced from PubChem (CID 175985284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).