C21H31NO3 — CID 140853677
benzyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate (PubChem CID 140853677) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is benzyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate.
| Compound Name | benzyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate |
|---|---|
| PubChem CID | 140853677 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | benzyl N-[(Z)-4-oxotridec-2-en-3-yl]carbamate |
| SMILES | C/C=C(\NC(=O)OCc1ccccc1)C(=O)CCCCCCCCC |
| InChI | InChI=1S/C21H31NO3/c1-3-5-6-7-8-9-13-16-20(23)19(4-2)22-21(24)25-17-18-14-11-10-12-15-18/h4,10-12,14-15H,3,5-9,13,16-17H2,1-2H3,(H,22,24)/b19-4- |
| InChIKey | NKVZKMAVOUXHSG-PVOVUMCXSA-N |
| XLogP | 5.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|