C19H32N2O3 — CID 59890919
tert-butyl N-[(2R)-3-amino-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)carbamate (PubChem CID 59890919) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-amino-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)carbamate.
| Compound Name | tert-butyl N-[(2R)-3-amino-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 59890919 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | tert-butyl N-[(2R)-3-amino-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)carbamate |
| SMILES | CC(C)CN(C[C@@H](O)C(N)Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N2O3/c1-14(2)12-21(18(23)24-19(3,4)5)13-17(22)16(20)11-15-9-7-6-8-10-15/h6-10,14,16-17,22H,11-13,20H2,1-5H3/t16?,17-/m1/s1 |
| InChIKey | RASWJYITSNBFSK-ZYMOGRSISA-N |
| XLogP | 2.81 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |