C22H31N3O3 — CID 67669797
tert-butyl N-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-(benzylamino)carbamate (PubChem CID 67669797) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-(benzylamino)carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-(benzylamino)carbamate |
|---|---|
| PubChem CID | 67669797 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl N-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-(benzylamino)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C[C@H](O)[C@@H](N)Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C22H31N3O3/c1-22(2,3)28-21(27)25(24-15-18-12-8-5-9-13-18)16-20(26)19(23)14-17-10-6-4-7-11-17/h4-13,19-20,24,26H,14-16,23H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | ISRKIDYRLQSXNU-PMACEKPBSA-N |
| XLogP | 2.86 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|