C30H37N3O5 — CID 67671649
tert-butyl N-(benzylamino)-N-[(2S,3S)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butyl]carbamate (PubChem CID 67671649) has the molecular formula C30H37N3O5 and a molecular weight of 519.64 g/mol. Its IUPAC name is tert-butyl N-(benzylamino)-N-[(2S,3S)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butyl]carbamate.
| Compound Name | tert-butyl N-(benzylamino)-N-[(2S,3S)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butyl]carbamate |
|---|---|
| PubChem CID | 67671649 |
| Molecular Formula | C30H37N3O5 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | tert-butyl N-(benzylamino)-N-[(2S,3S)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C[C@H](O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C30H37N3O5/c1-30(2,3)38-29(36)33(31-20-24-15-9-5-10-16-24)21-27(34)26(19-23-13-7-4-8-14-23)32-28(35)37-22-25-17-11-6-12-18-25/h4-18,26-27,31,34H,19-22H2,1-3H3,(H,32,35)/t26-,27-/m0/s1 |
| InChIKey | RVGRKYLLLWEYBX-SVBPBHIXSA-N |
| XLogP | 4.83 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|