C29H41N3O5 — CID 10142337
tert-butyl N-[cyclohexyl-[(3S)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butyl]amino]carbamate (PubChem CID 10142337) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is tert-butyl N-[cyclohexyl-[(3S)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butyl]amino]carbamate.
| Compound Name | tert-butyl N-[cyclohexyl-[(3S)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butyl]amino]carbamate |
|---|---|
| PubChem CID | 10142337 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | tert-butyl N-[cyclohexyl-[(3S)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(CC(O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C29H41N3O5/c1-29(2,3)37-28(35)31-32(24-17-11-6-12-18-24)20-26(33)25(19-22-13-7-4-8-14-22)30-27(34)36-21-23-15-9-5-10-16-23/h4-5,7-10,13-16,24-26,33H,6,11-12,17-21H2,1-3H3,(H,30,34)(H,31,35)/t25-,26?/m0/s1 |
| InChIKey | KYLXGWGIGOZZPF-PMCHYTPCSA-N |
| XLogP | 4.96 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|