C26H37N3O6S — CID 22997008
tert-butyl N-[4-[(3-aminophenyl)sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 22997008) has the molecular formula C26H37N3O6S and a molecular weight of 519.66 g/mol. Its IUPAC name is tert-butyl N-[4-[(3-aminophenyl)sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(3-aminophenyl)sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 22997008 |
| Molecular Formula | C26H37N3O6S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | tert-butyl N-[4-[(3-aminophenyl)sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(O)CN(OC1CCCC1)S(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C26H37N3O6S/c1-26(2,3)34-25(31)28-23(16-19-10-5-4-6-11-19)24(30)18-29(35-21-13-7-8-14-21)36(32,33)22-15-9-12-20(27)17-22/h4-6,9-12,15,17,21,23-24,30H,7-8,13-14,16,18,27H2,1-3H3,(H,28,31) |
| InChIKey | PFNQPKGGVCTXHM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|