C24H30N2O8S — CID 87740680
[(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl(cyclohexyloxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 87740680) has the molecular formula C24H30N2O8S and a molecular weight of 506.58 g/mol. Its IUPAC name is [(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl(cyclohexyloxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl(cyclohexyloxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87740680 |
| Molecular Formula | C24H30N2O8S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | [(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl(cyclohexyloxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccccc1)[C@H](O)CN(OC1CCCCC1)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H30N2O8S/c27-21(20(25-24(28)29)13-17-7-3-1-4-8-17)15-26(34-18-9-5-2-6-10-18)35(30,31)19-11-12-22-23(14-19)33-16-32-22/h1,3-4,7-8,11-12,14,18,20-21,25,27H,2,5-6,9-10,13,15-16H2,(H,28,29)/t20-,21+/m0/s1 |
| InChIKey | WZEIEVVTLUTKSE-LEWJYISDSA-N |
| XLogP | 2.91 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|