C28H39N3O8S — CID 57123161
[(2S,3R)-4-[cyclopentyloxy-[4-(2-morpholin-4-ylethoxy)phenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 57123161) has the molecular formula C28H39N3O8S and a molecular weight of 577.70 g/mol. Its IUPAC name is [(2S,3R)-4-[cyclopentyloxy-[4-(2-morpholin-4-ylethoxy)phenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-4-[cyclopentyloxy-[4-(2-morpholin-4-ylethoxy)phenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 57123161 |
| Molecular Formula | C28H39N3O8S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | [(2S,3R)-4-[cyclopentyloxy-[4-(2-morpholin-4-ylethoxy)phenyl]sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccccc1)[C@H](O)CN(OC1CCCC1)S(=O)(=O)c1ccc(OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C28H39N3O8S/c32-27(26(29-28(33)34)20-22-6-2-1-3-7-22)21-31(39-24-8-4-5-9-24)40(35,36)25-12-10-23(11-13-25)38-19-16-30-14-17-37-18-15-30/h1-3,6-7,10-13,24,26-27,29,32H,4-5,8-9,14-21H2,(H,33,34)/t26-,27+/m0/s1 |
| InChIKey | YWMUOXLICOMUJN-RRPNLBNLSA-N |
| XLogP | 2.50 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|