C28H38N2O8S — CID 87740288
tert-butyl N-[(2S,3S)-4-[cyclopentyloxy(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 87740288) has the molecular formula C28H38N2O8S and a molecular weight of 562.69 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-4-[cyclopentyloxy(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-4-[cyclopentyloxy(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 87740288 |
| Molecular Formula | C28H38N2O8S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | tert-butyl N-[(2S,3S)-4-[cyclopentyloxy(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(OC1CCCC1)S(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C28H38N2O8S/c1-28(2,3)37-27(32)29-23(17-20-9-5-4-6-10-20)24(31)19-30(38-21-11-7-8-12-21)39(33,34)22-13-14-25-26(18-22)36-16-15-35-25/h4-6,9-10,13-14,18,21,23-24,31H,7-8,11-12,15-17,19H2,1-3H3,(H,29,32)/t23-,24-/m0/s1 |
| InChIKey | GIZWDJYUVFKDIU-ZEQRLZLVSA-N |
| XLogP | 3.82 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|