C28H40N2O4 — CID 59888607
tert-butyl N-[4-[cyclopentyloxy-[(3-methylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59888607) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is tert-butyl N-[4-[cyclopentyloxy-[(3-methylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[cyclopentyloxy-[(3-methylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59888607 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | tert-butyl N-[4-[cyclopentyloxy-[(3-methylphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | Cc1cccc(CN(CC(O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)OC2CCCC2)c1 |
| InChI | InChI=1S/C28H40N2O4/c1-21-11-10-14-23(17-21)19-30(34-24-15-8-9-16-24)20-26(31)25(18-22-12-6-5-7-13-22)29-27(32)33-28(2,3)4/h5-7,10-14,17,24-26,31H,8-9,15-16,18-20H2,1-4H3,(H,29,32) |
| InChIKey | MFOGOQJJUQWQHP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|