C29H38N2O7 — CID 59090670
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[cyclopentyloxy-[(3-hydroxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59090670) has the molecular formula C29H38N2O7 and a molecular weight of 526.63 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[cyclopentyloxy-[(3-hydroxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[cyclopentyloxy-[(3-hydroxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59090670 |
| Molecular Formula | C29H38N2O7 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[cyclopentyloxy-[(3-hydroxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(NC(Cc1ccccc1)C(O)CN(Cc1cccc(O)c1)OC1CCCC1)OC1COC2OCCC12 |
| InChI | InChI=1S/C29H38N2O7/c32-22-10-6-9-21(15-22)17-31(38-23-11-4-5-12-23)18-26(33)25(16-20-7-2-1-3-8-20)30-29(34)37-27-19-36-28-24(27)13-14-35-28/h1-3,6-10,15,23-28,32-33H,4-5,11-14,16-19H2,(H,30,34) |
| InChIKey | WQXDGUHHQZXJRT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|