C30H38N4O8S — CID 87740857
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3S)-4-[[3-(cyanomethylamino)phenyl]sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 87740857) has the molecular formula C30H38N4O8S and a molecular weight of 614.72 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3S)-4-[[3-(cyanomethylamino)phenyl]sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3S)-4-[[3-(cyanomethylamino)phenyl]sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 87740857 |
| Molecular Formula | C30H38N4O8S |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3S)-4-[[3-(cyanomethylamino)phenyl]sulfonyl-cyclopentyloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | N#CCNc1cccc(S(=O)(=O)N(C[C@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CO[C@H]3OCC[C@H]32)OC2CCCC2)c1 |
| InChI | InChI=1S/C30H38N4O8S/c31-14-15-32-22-9-6-12-24(18-22)43(37,38)34(42-23-10-4-5-11-23)19-27(35)26(17-21-7-2-1-3-8-21)33-30(36)41-28-20-40-29-25(28)13-16-39-29/h1-3,6-9,12,18,23,25-29,32,35H,4-5,10-11,13,15-17,19-20H2,(H,33,36)/t25-,26-,27-,28-,29+/m0/s1 |
| InChIKey | PWMNLIYJJPVWPZ-MYHRABSESA-N |
| XLogP | 2.95 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|