C30H40N2O9S — CID 59787868
[(3R,3aS,7aR)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl] N-[(2S,3R)-4-[cyclopentyloxy-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59787868) has the molecular formula C30H40N2O9S and a molecular weight of 604.72 g/mol. Its IUPAC name is [(3R,3aS,7aR)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl] N-[(2S,3R)-4-[cyclopentyloxy-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3R,3aS,7aR)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl] N-[(2S,3R)-4-[cyclopentyloxy-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59787868 |
| Molecular Formula | C30H40N2O9S |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | [(3R,3aS,7aR)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl] N-[(2S,3R)-4-[cyclopentyloxy-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CO[C@H]3OCCC[C@H]32)OC2CCCC2)cc1 |
| InChI | InChI=1S/C30H40N2O9S/c1-37-22-13-15-24(16-14-22)42(35,36)32(41-23-10-5-6-11-23)19-27(33)26(18-21-8-3-2-4-9-21)31-30(34)40-28-20-39-29-25(28)12-7-17-38-29/h2-4,8-9,13-16,23,25-29,33H,5-7,10-12,17-20H2,1H3,(H,31,34)/t25-,26-,27+,28-,29+/m0/s1 |
| InChIKey | CXXNLIQHVANWNP-WNJKUOTESA-N |
| XLogP | 3.41 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|