C29H39N3O10S — CID 58779306
tert-butyl N-[[(2R,3S)-3-[[(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]carbamate (PubChem CID 58779306) has the molecular formula C29H39N3O10S and a molecular weight of 621.71 g/mol. Its IUPAC name is tert-butyl N-[[(2R,3S)-3-[[(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]carbamate.
| Compound Name | tert-butyl N-[[(2R,3S)-3-[[(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 58779306 |
| Molecular Formula | C29H39N3O10S |
| Molecular Weight | 621.71 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | tert-butyl N-[[(2R,3S)-3-[[(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CO[C@H]3OCCC32)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H39N3O10S/c1-29(2,3)42-28(35)31-32(43(36,37)21-12-10-20(38-4)11-13-21)17-24(33)23(16-19-8-6-5-7-9-19)30-27(34)41-25-18-40-26-22(25)14-15-39-26/h5-13,22-26,33H,14-18H2,1-4H3,(H,30,34)(H,31,35)/t22?,23-,24+,25-,26+/m0/s1 |
| InChIKey | QCZXBCYKBUPPEE-CGQFLDJJSA-N |
| XLogP | 2.59 |
| TPSA | 161.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.71 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|