C30H35N3O7S — CID 10099772
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-benzylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 10099772) has the molecular formula C30H35N3O7S and a molecular weight of 581.69 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-benzylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-benzylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10099772 |
| Molecular Formula | C30H35N3O7S |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-benzylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | Nc1ccc(S(=O)(=O)N(Cc2ccccc2)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COC3OCCC23)cc1 |
| InChI | InChI=1S/C30H35N3O7S/c31-23-11-13-24(14-12-23)41(36,37)33(18-22-9-5-2-6-10-22)19-27(34)26(17-21-7-3-1-4-8-21)32-30(35)40-28-20-39-29-25(28)15-16-38-29/h1-14,25-29,34H,15-20,31H2,(H,32,35)/t25?,26-,27+,28?,29?/m0/s1 |
| InChIKey | WOXLFHHATOPRGU-BBJHSNORSA-N |
| XLogP | 2.92 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|