C28H38N2O7S — CID 10076146
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[benzenesulfonyl(3-methylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 10076146) has the molecular formula C28H38N2O7S and a molecular weight of 546.69 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[benzenesulfonyl(3-methylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[benzenesulfonyl(3-methylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10076146 |
| Molecular Formula | C28H38N2O7S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[benzenesulfonyl(3-methylbutyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)CCN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1COC2OCCC12)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H38N2O7S/c1-20(2)13-15-30(38(33,34)22-11-7-4-8-12-22)18-25(31)24(17-21-9-5-3-6-10-21)29-28(32)37-26-19-36-27-23(26)14-16-35-27/h3-12,20,23-27,31H,13-19H2,1-2H3,(H,29,32)/t23?,24-,25+,26?,27?/m0/s1 |
| InChIKey | AYQGBQFEFYEQIB-OQCZMMSSSA-N |
| XLogP | 3.18 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |