C29H33N3O7S — CID 10370721
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[benzenesulfonyl(pyridin-2-ylmethyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 10370721) has the molecular formula C29H33N3O7S and a molecular weight of 567.66 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[benzenesulfonyl(pyridin-2-ylmethyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[benzenesulfonyl(pyridin-2-ylmethyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10370721 |
| Molecular Formula | C29H33N3O7S |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-4-[benzenesulfonyl(pyridin-2-ylmethyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H](O)CN(Cc1ccccn1)S(=O)(=O)c1ccccc1)OC1COC2OCCC12 |
| InChI | InChI=1S/C29H33N3O7S/c33-26(19-32(18-22-11-7-8-15-30-22)40(35,36)23-12-5-2-6-13-23)25(17-21-9-3-1-4-10-21)31-29(34)39-27-20-38-28-24(27)14-16-37-28/h1-13,15,24-28,33H,14,16-20H2,(H,31,34)/t24?,25-,26+,27?,28?/m0/s1 |
| InChIKey | JAZBSIWEQBLKJD-DHKACNSJSA-N |
| XLogP | 2.73 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |