C29H40N2O8S — CID 59132292
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-(4-methylphenyl)butan-2-yl]carbamate (PubChem CID 59132292) has the molecular formula C29H40N2O8S and a molecular weight of 576.71 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-(4-methylphenyl)butan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-(4-methylphenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 59132292 |
| Molecular Formula | C29H40N2O8S |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-(4-methylphenyl)butan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)CC(O)C(Cc2ccc(C)cc2)NC(=O)OC2COC3OCCC23)cc1 |
| InChI | InChI=1S/C29H40N2O8S/c1-19(2)16-31(40(34,35)23-11-9-22(36-4)10-12-23)17-26(32)25(15-21-7-5-20(3)6-8-21)30-29(33)39-27-18-38-28-24(27)13-14-37-28/h5-12,19,24-28,32H,13-18H2,1-4H3,(H,30,33) |
| InChIKey | HWBMZWRKCSJNLB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |