C29H38N2O9S — CID 89027773
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(3R)-1-(4-formylphenyl)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate (PubChem CID 89027773) has the molecular formula C29H38N2O9S and a molecular weight of 590.70 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(3R)-1-(4-formylphenyl)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(3R)-1-(4-formylphenyl)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 89027773 |
| Molecular Formula | C29H38N2O9S |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(3R)-1-(4-formylphenyl)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)C(Cc2ccc(C=O)cc2)NC(=O)O[C@H]2CO[C@H]3OCC[C@H]32)cc1 |
| InChI | InChI=1S/C29H38N2O9S/c1-19(2)15-31(41(35,36)23-10-8-22(37-3)9-11-23)16-26(33)25(14-20-4-6-21(17-32)7-5-20)30-29(34)40-27-18-39-28-24(27)12-13-38-28/h4-11,17,19,24-28,33H,12-16,18H2,1-3H3,(H,30,34)/t24-,25?,26+,27-,28+/m0/s1 |
| InChIKey | PAMFEVCTEISLEF-NHTZSTRKSA-N |
| XLogP | 2.61 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|