C33H42N4O10S2 — CID 20774222
[4-[2-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxybutyl]phenyl] 4-aminobenzenesulfonate (PubChem CID 20774222) has the molecular formula C33H42N4O10S2 and a molecular weight of 718.85 g/mol. Its IUPAC name is [4-[2-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxybutyl]phenyl] 4-aminobenzenesulfonate.
| Compound Name | [4-[2-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxybutyl]phenyl] 4-aminobenzenesulfonate |
|---|---|
| PubChem CID | 20774222 |
| Molecular Formula | C33H42N4O10S2 |
| Molecular Weight | 718.85 g/mol |
| Exact Mass | 718.23 |
| IUPAC Name | [4-[2-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxybutyl]phenyl] 4-aminobenzenesulfonate |
| SMILES | CC(C)CN(CC(O)C(Cc1ccc(OS(=O)(=O)c2ccc(N)cc2)cc1)NC(=O)OC1COC2OCCC12)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C33H42N4O10S2/c1-21(2)18-37(48(40,41)26-11-5-23(34)6-12-26)19-30(38)29(36-33(39)46-31-20-45-32-28(31)15-16-44-32)17-22-3-9-25(10-4-22)47-49(42,43)27-13-7-24(35)8-14-27/h3-14,21,28-32,38H,15-20,34-35H2,1-2H3,(H,36,39) |
| InChIKey | CTDCMYGKYVPNKG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 209.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|