C32H42N4O8S2 — CID 20774224
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-yl]carbamate (PubChem CID 20774224) has the molecular formula C32H42N4O8S2 and a molecular weight of 674.84 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 20774224 |
| Molecular Formula | C32H42N4O8S2 |
| Molecular Weight | 674.84 g/mol |
| Exact Mass | 674.24 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]butan-2-yl]carbamate |
| SMILES | Cc1nc(COc2ccc(CC(NC(=O)OC3COC4OCCC34)C(O)CN(CC(C)C)S(=O)(=O)c3ccc(N)cc3)cc2)cs1 |
| InChI | InChI=1S/C32H42N4O8S2/c1-20(2)15-36(46(39,40)26-10-6-23(33)7-11-26)16-29(37)28(35-32(38)44-30-18-43-31-27(30)12-13-41-31)14-22-4-8-25(9-5-22)42-17-24-19-45-21(3)34-24/h4-11,19-20,27-31,37H,12-18,33H2,1-3H3,(H,35,38) |
| InChIKey | IJTZEXLTSSADBZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 162.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|