C29H38N2O8S — CID 89441409
[(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-1-(4-formylphenyl)-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate (PubChem CID 89441409) has the molecular formula C29H38N2O8S and a molecular weight of 574.70 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-1-(4-formylphenyl)-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate.
| Compound Name | [(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-1-(4-formylphenyl)-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 89441409 |
| Molecular Formula | C29H38N2O8S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-1-(4-formylphenyl)-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC[C@H](Cc2ccc(C=O)cc2)NC(=O)OC2CO[C@H]3OCC[C@@H]23)CC(C)C)cc1 |
| InChI | InChI=1S/C29H38N2O8S/c1-20(2)17-31(40(34,35)25-10-8-24(36-3)9-11-25)14-12-23(16-21-4-6-22(18-32)7-5-21)30-29(33)39-27-19-38-28-26(27)13-15-37-28/h4-11,18,20,23,26-28H,12-17,19H2,1-3H3,(H,30,33)/t23-,26+,27?,28-/m1/s1 |
| InChIKey | ANPNFWLZHPTWBP-WQBKLWKOSA-N |
| XLogP | 3.64 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|