C28H39N3O7S — CID 24994784
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-amino-4-[butyl-(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 24994784) has the molecular formula C28H39N3O7S and a molecular weight of 561.70 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-amino-4-[butyl-(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-amino-4-[butyl-(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 24994784 |
| Molecular Formula | C28H39N3O7S |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-amino-4-[butyl-(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CCCCN(C[C@@H](N)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CO[C@H]2OCC[C@H]21)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H39N3O7S/c1-3-4-15-31(39(33,34)22-12-10-21(35-2)11-13-22)18-24(29)25(17-20-8-6-5-7-9-20)30-28(32)38-26-19-37-27-23(26)14-16-36-27/h5-13,23-27H,3-4,14-19,29H2,1-2H3,(H,30,32)/t23-,24+,25-,26-,27+/m0/s1 |
| InChIKey | BQRFUOWYTQUFDQ-PWTLFHGOSA-N |
| XLogP | 2.91 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |