C40H61N2O12PS — CID 89111541
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-butoxy-4-[2-(dibutoxyphosphorylmethoxy)prop-2-enyl-(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 89111541) has the molecular formula C40H61N2O12PS and a molecular weight of 824.97 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-butoxy-4-[2-(dibutoxyphosphorylmethoxy)prop-2-enyl-(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-butoxy-4-[2-(dibutoxyphosphorylmethoxy)prop-2-enyl-(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 89111541 |
| Molecular Formula | C40H61N2O12PS |
| Molecular Weight | 824.97 g/mol |
| Exact Mass | 824.37 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[3-butoxy-4-[2-(dibutoxyphosphorylmethoxy)prop-2-enyl-(4-methoxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | C=C(CN(CC(OCCCC)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12)S(=O)(=O)c1ccc(OC)cc1)OCP(=O)(OCCCC)OCCCC |
| InChI | InChI=1S/C40H61N2O12PS/c1-6-9-22-48-37(36(26-32-15-13-12-14-16-32)41-40(43)54-38-29-50-39-35(38)21-25-49-39)28-42(56(45,46)34-19-17-33(47-5)18-20-34)27-31(4)51-30-55(44,52-23-10-7-2)53-24-11-8-3/h12-20,35-39H,4,6-11,21-30H2,1-3,5H3,(H,41,43) |
| InChIKey | XSKDCEIBBIVTJT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 157.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.97 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|