C46H59N2O11PS — CID 59131923
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[6-bis(phenylmethoxy)phosphoryl-2,2-dimethylhexyl]-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59131923) has the molecular formula C46H59N2O11PS and a molecular weight of 879.02 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[6-bis(phenylmethoxy)phosphoryl-2,2-dimethylhexyl]-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[6-bis(phenylmethoxy)phosphoryl-2,2-dimethylhexyl]-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59131923 |
| Molecular Formula | C46H59N2O11PS |
| Molecular Weight | 879.02 g/mol |
| Exact Mass | 878.36 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[[6-bis(phenylmethoxy)phosphoryl-2,2-dimethylhexyl]-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(O)C(Cc2ccccc2)NC(=O)OC2COC3OCCC23)CC(C)(C)CCCCP(=O)(OCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C46H59N2O11PS/c1-46(2,26-13-14-28-60(51,57-31-36-17-9-5-10-18-36)58-32-37-19-11-6-12-20-37)34-48(61(52,53)39-23-21-38(54-3)22-24-39)30-42(49)41(29-35-15-7-4-8-16-35)47-45(50)59-43-33-56-44-40(43)25-27-55-44/h4-12,15-24,40-44,49H,13-14,25-34H2,1-3H3,(H,47,50) |
| InChIKey | XXBXJCXZUNNZNS-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 159.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.02 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|