C30H39N3O8S — CID 20706529
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(4-cyano-2,2-dimethylbutyl)-(4-hydroxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 20706529) has the molecular formula C30H39N3O8S and a molecular weight of 601.72 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(4-cyano-2,2-dimethylbutyl)-(4-hydroxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(4-cyano-2,2-dimethylbutyl)-(4-hydroxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 20706529 |
| Molecular Formula | C30H39N3O8S |
| Molecular Weight | 601.72 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[(4-cyano-2,2-dimethylbutyl)-(4-hydroxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(CCC#N)CN(CC(O)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12)S(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H39N3O8S/c1-30(2,14-6-15-31)20-33(42(37,38)23-11-9-22(34)10-12-23)18-26(35)25(17-21-7-4-3-5-8-21)32-29(36)41-27-19-40-28-24(27)13-16-39-28/h3-5,7-12,24-28,34-35H,6,13-14,16-20H2,1-2H3,(H,32,36) |
| InChIKey | PBHFMQGZAHHFGZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 158.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |