C31H48N5O11PS — CID 158842120
diazanium;[(3S)-3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-1-[(4-cyano-2,2-dimethylbutyl)-(4-methoxyphenyl)sulfonylamino]-4-phenylbutan-2-yl] phosphate (PubChem CID 158842120) has the molecular formula C31H48N5O11PS and a molecular weight of 729.79 g/mol. Its IUPAC name is diazanium;[(3S)-3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-1-[(4-cyano-2,2-dimethylbutyl)-(4-methoxyphenyl)sulfonylamino]-4-phenylbutan-2-yl] phosphate.
| Compound Name | diazanium;[(3S)-3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-1-[(4-cyano-2,2-dimethylbutyl)-(4-methoxyphenyl)sulfonylamino]-4-phenylbutan-2-yl] phosphate |
|---|---|
| PubChem CID | 158842120 |
| Molecular Formula | C31H48N5O11PS |
| Molecular Weight | 729.79 g/mol |
| Exact Mass | 729.28 |
| IUPAC Name | diazanium;[(3S)-3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-1-[(4-cyano-2,2-dimethylbutyl)-(4-methoxyphenyl)sulfonylamino]-4-phenylbutan-2-yl] phosphate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(OP(=O)([O-])[O-])[C@H](Cc2ccccc2)NC(=O)OC2COC3OCCC23)CC(C)(C)CCC#N)cc1.[NH4+].[NH4+] |
| InChI | InChI=1S/C31H42N3O11PS.2H3N/c1-31(2,15-7-16-32)21-34(47(39,40)24-12-10-23(41-3)11-13-24)19-27(45-46(36,37)38)26(18-22-8-5-4-6-9-22)33-30(35)44-28-20-43-29-25(28)14-17-42-29;;/h4-6,8-13,25-29H,7,14-15,17-21H2,1-3H3,(H,33,35)(H2,36,37,38);2*1H3/t25?,26-,27?,28?,29?;;/m0../s1 |
| InChIKey | MHIBEAHPPCAOSG-YKZQMKKPSA-N |
| XLogP | 3.08 |
| TPSA | 272.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|