C24H35N3O8S — CID 59927767
[(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-3-[(4-cyano-2,2-dimethylbutyl)-(4-methoxyphenyl)sulfonylamino]-2-hydroxypropyl]carbamate (PubChem CID 59927767) has the molecular formula C24H35N3O8S and a molecular weight of 525.62 g/mol. Its IUPAC name is [(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-3-[(4-cyano-2,2-dimethylbutyl)-(4-methoxyphenyl)sulfonylamino]-2-hydroxypropyl]carbamate.
| Compound Name | [(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-3-[(4-cyano-2,2-dimethylbutyl)-(4-methoxyphenyl)sulfonylamino]-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 59927767 |
| Molecular Formula | C24H35N3O8S |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | [(3aS,4S,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-3-[(4-cyano-2,2-dimethylbutyl)-(4-methoxyphenyl)sulfonylamino]-2-hydroxypropyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(C[C@@H](O)CNC(=O)O[C@@H]2CO[C@H]3OCC[C@H]32)CC(C)(C)CCC#N)cc1 |
| InChI | InChI=1S/C24H35N3O8S/c1-24(2,10-4-11-25)16-27(36(30,31)19-7-5-18(32-3)6-8-19)14-17(28)13-26-23(29)35-21-15-34-22-20(21)9-12-33-22/h5-8,17,20-22,28H,4,9-10,12-16H2,1-3H3,(H,26,29)/t17-,20-,21+,22+/m0/s1 |
| InChIKey | NEEIEDAOOOTUTI-GUGJDKNPSA-N |
| XLogP | 1.86 |
| TPSA | 147.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |